About [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol
[3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol (PubChem CID 123409924) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol.
Molecular Properties
| Compound Name | [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol |
| PubChem CID | 123409924 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol |
| SMILES | Nc1ccccc1C1OC2(CCCCC2)OC1CO |
| InChI | InChI=1S/C15H21NO3/c16-12-7-3-2-6-11(12)14-13(10-17)18-15(19-14)8-4-1-5-9-15/h2-3,6-7,13-14,17H,1,4-5,8-10,16H2 |
| InChIKey | RWVPSIQUZPDZIY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol?
The IUPAC name of [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol (CID 123409924) is [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol.
What is the SMILES notation for [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol?
The canonical SMILES for [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol is Nc1ccccc1C1OC2(CCCCC2)OC1CO.
What is the InChIKey of [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol?
The InChIKey is RWVPSIQUZPDZIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c16-12-7-3-2-6-11(12)14-13(10-17)18-15(19-14)8-4-1-5-9-15/h2-3,6-7,13-14,17H,1,4-5,8-10,16H2.
What are the key properties of [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol?
[3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol has a molecular weight of 263.34 g/mol, XLogP of 2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-aminophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol is sourced from PubChem (CID 123409924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).