C14H21F6N — CID 123409973
2,6-diethyl-4-(1,1,1,2,3,3-hexafluorobutan-2-yl)cyclohex-3-en-1-amine (PubChem CID 123409973) has the molecular formula C14H21F6N and a molecular weight of 317.32 g/mol. Its IUPAC name is 2,6-diethyl-4-(1,1,1,2,3,3-hexafluorobutan-2-yl)cyclohex-3-en-1-amine.
| Compound Name | 2,6-diethyl-4-(1,1,1,2,3,3-hexafluorobutan-2-yl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 123409973 |
| Molecular Formula | C14H21F6N |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2,6-diethyl-4-(1,1,1,2,3,3-hexafluorobutan-2-yl)cyclohex-3-en-1-amine |
| SMILES | CCC1C=C(C(F)(C(C)(F)F)C(F)(F)F)CC(CC)C1N |
| InChI | InChI=1S/C14H21F6N/c1-4-8-6-10(7-9(5-2)11(8)21)13(17,12(3,15)16)14(18,19)20/h6,8-9,11H,4-5,7,21H2,1-3H3 |
| InChIKey | RWUSPPCOCSECSY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|