About 4-sulfanylcyclohepta-2,6-diene-1-thione
4-sulfanylcyclohepta-2,6-diene-1-thione (PubChem CID 123410312) has the molecular formula C7H8S2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 4-sulfanylcyclohepta-2,6-diene-1-thione.
Molecular Properties
| Compound Name | 4-sulfanylcyclohepta-2,6-diene-1-thione |
| PubChem CID | 123410312 |
| Molecular Formula | C7H8S2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.01 |
| IUPAC Name | 4-sulfanylcyclohepta-2,6-diene-1-thione |
| SMILES | S=C1C=CCC(S)C=C1 |
| InChI | InChI=1S/C7H8S2/c8-6-2-1-3-7(9)5-4-6/h1-2,4-5,7,9H,3H2 |
| InChIKey | RSWQSADZTHXODN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylcyclohepta-2,6-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylcyclohepta-2,6-diene-1-thione?
The IUPAC name of 4-sulfanylcyclohepta-2,6-diene-1-thione (CID 123410312) is 4-sulfanylcyclohepta-2,6-diene-1-thione.
What is the SMILES notation for 4-sulfanylcyclohepta-2,6-diene-1-thione?
The canonical SMILES for 4-sulfanylcyclohepta-2,6-diene-1-thione is S=C1C=CCC(S)C=C1.
What is the InChIKey of 4-sulfanylcyclohepta-2,6-diene-1-thione?
The InChIKey is RSWQSADZTHXODN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S2/c8-6-2-1-3-7(9)5-4-6/h1-2,4-5,7,9H,3H2.
What are the key properties of 4-sulfanylcyclohepta-2,6-diene-1-thione?
4-sulfanylcyclohepta-2,6-diene-1-thione has a molecular weight of 156.27 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylcyclohepta-2,6-diene-1-thione is sourced from PubChem (CID 123410312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).