C16H40N4Si — CID 123410759
1-N,1-N',2-N-tri(butan-2-yl)-2-methyl-1-N"-silylpropane-1,1,1,2-tetramine (PubChem CID 123410759) has the molecular formula C16H40N4Si and a molecular weight of 316.61 g/mol. Its IUPAC name is 1-N,1-N',2-N-tri(butan-2-yl)-2-methyl-1-N"-silylpropane-1,1,1,2-tetramine.
| Compound Name | 1-N,1-N',2-N-tri(butan-2-yl)-2-methyl-1-N"-silylpropane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 123410759 |
| Molecular Formula | C16H40N4Si |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 316.30 |
| IUPAC Name | 1-N,1-N',2-N-tri(butan-2-yl)-2-methyl-1-N"-silylpropane-1,1,1,2-tetramine |
| SMILES | CCC(C)NC(C)(C)C(N[SiH3])(NC(C)CC)NC(C)CC |
| InChI | InChI=1S/C16H40N4Si/c1-9-12(4)17-15(7,8)16(20-21,18-13(5)10-2)19-14(6)11-3/h12-14,17-20H,9-11H2,1-8,21H3 |
| InChIKey | NVRHQFWPZNDAHM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|