C25H33N3O4S — CID 123410942
N-[5-(2-hydroxyethylsulfamoyl)cyclohexa-1,3-dien-1-yl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 123410942) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[5-(2-hydroxyethylsulfamoyl)cyclohexa-1,3-dien-1-yl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | N-[5-(2-hydroxyethylsulfamoyl)cyclohexa-1,3-dien-1-yl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 123410942 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[5-(2-hydroxyethylsulfamoyl)cyclohexa-1,3-dien-1-yl]-4-(3,4,5,6-tetrahydro-1H-isoquinolin-2-ylmethyl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | O=C(NC1=CC=CC(S(=O)(=O)NCCO)C1)C1=CC=C(CN2CCC3=C(C=CCC3)C2)CC1 |
| InChI | InChI=1S/C25H33N3O4S/c29-15-13-26-33(31,32)24-7-3-6-23(16-24)27-25(30)21-10-8-19(9-11-21)17-28-14-12-20-4-1-2-5-22(20)18-28/h2-3,5-8,10,24,26,29H,1,4,9,11-18H2,(H,27,30) |
| InChIKey | GNDNBHFVDYWJCM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |