About N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine
N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine (PubChem CID 123411150) has the molecular formula C11H28N2Si
and a molecular weight of 216.44 g/mol. Its IUPAC name is N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine |
| PubChem CID | 123411150 |
| Molecular Formula | C11H28N2Si |
| Molecular Weight | 216.44 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine |
| SMILES | CCN(CC)CN[SiH2]CCC(C)(C)C |
| InChI | InChI=1S/C11H28N2Si/c1-6-13(7-2)10-12-14-9-8-11(3,4)5/h12H,6-10,14H2,1-5H3 |
| InChIKey | FKYWNQBRSONEJE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine?
The IUPAC name of N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine (CID 123411150) is N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine.
What is the SMILES notation for N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine?
The canonical SMILES for N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine is CCN(CC)CN[SiH2]CCC(C)(C)C.
What is the InChIKey of N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine?
The InChIKey is FKYWNQBRSONEJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28N2Si/c1-6-13(7-2)10-12-14-9-8-11(3,4)5/h12H,6-10,14H2,1-5H3.
What are the key properties of N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine?
N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine has a molecular weight of 216.44 g/mol, XLogP of 1.81, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutylsilyl)-N',N'-diethylmethanediamine is sourced from PubChem (CID 123411150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).