About (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol
(7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol (PubChem CID 123411719) has the molecular formula C11H15ClO2
and a molecular weight of 214.69 g/mol. Its IUPAC name is (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol.
Molecular Properties
| Compound Name | (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol |
| PubChem CID | 123411719 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol |
| SMILES | COC1=C(Cl)C=CC(C)CC=C1CO |
| InChI | InChI=1S/C11H15ClO2/c1-8-3-5-9(7-13)11(14-2)10(12)6-4-8/h4-6,8,13H,3,7H2,1-2H3 |
| InChIKey | ZVNRYECVSJKMAA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol?
The IUPAC name of (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol (CID 123411719) is (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol.
What is the SMILES notation for (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol?
The canonical SMILES for (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol is COC1=C(Cl)C=CC(C)CC=C1CO.
What is the InChIKey of (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol?
The InChIKey is ZVNRYECVSJKMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO2/c1-8-3-5-9(7-13)11(14-2)10(12)6-4-8/h4-6,8,13H,3,7H2,1-2H3.
What are the key properties of (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol?
(7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol has a molecular weight of 214.69 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-8-methoxy-4-methylcycloocta-1,5,7-trien-1-yl)methanol is sourced from PubChem (CID 123411719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).