About (5Z)-N-methylocta-5,7-dien-4-imine
(5Z)-N-methylocta-5,7-dien-4-imine (PubChem CID 123411844) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is (5Z)-N-methylocta-5,7-dien-4-imine.
Molecular Properties
| Compound Name | (5Z)-N-methylocta-5,7-dien-4-imine |
| PubChem CID | 123411844 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (5Z)-N-methylocta-5,7-dien-4-imine |
| SMILES | C=C/C=C\C(CCC)=N\C |
| InChI | InChI=1S/C9H15N/c1-4-6-8-9(10-3)7-5-2/h4,6,8H,1,5,7H2,2-3H3/b8-6-,10-9+ |
| InChIKey | ZRZOLPMJDRTDLU-JWJWWGMXSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-N-methylocta-5,7-dien-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-N-methylocta-5,7-dien-4-imine?
The IUPAC name of (5Z)-N-methylocta-5,7-dien-4-imine (CID 123411844) is (5Z)-N-methylocta-5,7-dien-4-imine.
What is the SMILES notation for (5Z)-N-methylocta-5,7-dien-4-imine?
The canonical SMILES for (5Z)-N-methylocta-5,7-dien-4-imine is C=C/C=C\C(CCC)=N\C.
What is the InChIKey of (5Z)-N-methylocta-5,7-dien-4-imine?
The InChIKey is ZRZOLPMJDRTDLU-JWJWWGMXSA-N. The full InChI is InChI=1S/C9H15N/c1-4-6-8-9(10-3)7-5-2/h4,6,8H,1,5,7H2,2-3H3/b8-6-,10-9+.
What are the key properties of (5Z)-N-methylocta-5,7-dien-4-imine?
(5Z)-N-methylocta-5,7-dien-4-imine has a molecular weight of 137.23 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-N-methylocta-5,7-dien-4-imine is sourced from PubChem (CID 123411844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).