C24H41NO4 — CID 123411903
4-(7-amino-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid (PubChem CID 123411903) has the molecular formula C24H41NO4 and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-(7-amino-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid.
| Compound Name | 4-(7-amino-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid |
|---|---|
| PubChem CID | 123411903 |
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 4-(7-amino-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(CCC12C)C1(C)CCC(O)CC1CC3(N)O |
| InChI | InChI=1S/C24H41NO4/c1-14(4-7-20(27)28)17-5-6-18-21-19(9-11-23(17,18)3)22(2)10-8-16(26)12-15(22)13-24(21,25)29/h14-19,21,26,29H,4-13,25H2,1-3H3,(H,27,28) |
| InChIKey | KOJHJKJJKMBVDH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|