About 3-butyl-4-methylhepta-3,5,6-trien-2-imine
3-butyl-4-methylhepta-3,5,6-trien-2-imine (PubChem CID 123412060) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-butyl-4-methylhepta-3,5,6-trien-2-imine.
Molecular Properties
| Compound Name | 3-butyl-4-methylhepta-3,5,6-trien-2-imine |
| PubChem CID | 123412060 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3-butyl-4-methylhepta-3,5,6-trien-2-imine |
| SMILES | [H]/N=C(\C)C(CCCC)=C(C)C=C=C |
| InChI | InChI=1S/C12H19N/c1-5-7-9-12(11(4)13)10(3)8-6-2/h8,13H,2,5,7,9H2,1,3-4H3/b12-10?,13-11+ |
| InChIKey | ZKMUIWBEMQDDKH-SQBYBMFESA-N |
| XLogP | 3.87 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-4-methylhepta-3,5,6-trien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-methylhepta-3,5,6-trien-2-imine?
The IUPAC name of 3-butyl-4-methylhepta-3,5,6-trien-2-imine (CID 123412060) is 3-butyl-4-methylhepta-3,5,6-trien-2-imine.
What is the SMILES notation for 3-butyl-4-methylhepta-3,5,6-trien-2-imine?
The canonical SMILES for 3-butyl-4-methylhepta-3,5,6-trien-2-imine is [H]/N=C(\C)C(CCCC)=C(C)C=C=C.
What is the InChIKey of 3-butyl-4-methylhepta-3,5,6-trien-2-imine?
The InChIKey is ZKMUIWBEMQDDKH-SQBYBMFESA-N. The full InChI is InChI=1S/C12H19N/c1-5-7-9-12(11(4)13)10(3)8-6-2/h8,13H,2,5,7,9H2,1,3-4H3/b12-10?,13-11+.
What are the key properties of 3-butyl-4-methylhepta-3,5,6-trien-2-imine?
3-butyl-4-methylhepta-3,5,6-trien-2-imine has a molecular weight of 177.29 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-methylhepta-3,5,6-trien-2-imine is sourced from PubChem (CID 123412060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).