C9H7ClFNO2 — CID 123412140
5-chloro-7-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one (PubChem CID 123412140) has the molecular formula C9H7ClFNO2 and a molecular weight of 215.61 g/mol. Its IUPAC name is 5-chloro-7-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one.
| Compound Name | 5-chloro-7-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 123412140 |
| Molecular Formula | C9H7ClFNO2 |
| Molecular Weight | 215.61 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 5-chloro-7-fluoro-6-hydroxy-2-methyl-3H-isoindol-1-one |
| SMILES | CN1Cc2cc(Cl)c(O)c(F)c2C1=O |
| InChI | InChI=1S/C9H7ClFNO2/c1-12-3-4-2-5(10)8(13)7(11)6(4)9(12)14/h2,13H,3H2,1H3 |
| InChIKey | LDUDZQBHWFMXMW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.61 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |