About (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium
(3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium (PubChem CID 123412539) has the molecular formula C5H9F2N
and a molecular weight of 121.13 g/mol. Its IUPAC name is (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium.
Molecular Properties
| Compound Name | (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium |
| PubChem CID | 123412539 |
| Molecular Formula | C5H9F2N |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium |
| SMILES | [CH2-][NH+]1C[C@@H](F)[C@H](F)C1 |
| InChI | InChI=1S/C5H9F2N/c1-8-2-4(6)5(7)3-8/h4-5,8H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | OBDCXGBGCLGNEG-RFZPGFLSSA-N |
| XLogP | -0.65 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium?
The IUPAC name of (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium (CID 123412539) is (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium.
What is the SMILES notation for (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium?
The canonical SMILES for (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium is [CH2-][NH+]1C[C@@H](F)[C@H](F)C1.
What is the InChIKey of (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium?
The InChIKey is OBDCXGBGCLGNEG-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H9F2N/c1-8-2-4(6)5(7)3-8/h4-5,8H,1-3H2/t4-,5-/m1/s1.
What are the key properties of (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium?
(3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium has a molecular weight of 121.13 g/mol, XLogP of -0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3,4-difluoro-1-methanidylpyrrolidin-1-ium is sourced from PubChem (CID 123412539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).