C8H8Cl2N2 — CID 123412809
6,8-dichloro-1,4,8,8a-tetrahydro-2,7-naphthyridine (PubChem CID 123412809) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is 6,8-dichloro-1,4,8,8a-tetrahydro-2,7-naphthyridine.
| Compound Name | 6,8-dichloro-1,4,8,8a-tetrahydro-2,7-naphthyridine |
|---|---|
| PubChem CID | 123412809 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 6,8-dichloro-1,4,8,8a-tetrahydro-2,7-naphthyridine |
| SMILES | ClC1=NC(Cl)C2CN=CCC2=C1 |
| InChI | InChI=1S/C8H8Cl2N2/c9-7-3-5-1-2-11-4-6(5)8(10)12-7/h2-3,6,8H,1,4H2 |
| InChIKey | CKQILAMEWWDWBB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|