C16H20ClN3OS — CID 123412912
6-(2-chlorophenyl)-N,N-diethyl-4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 123412912) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-N,N-diethyl-4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 6-(2-chlorophenyl)-N,N-diethyl-4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123412912 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 6-(2-chlorophenyl)-N,N-diethyl-4-methyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CCN(CC)C(=O)C1C(C)=NC(=S)NC1c1ccccc1Cl |
| InChI | InChI=1S/C16H20ClN3OS/c1-4-20(5-2)15(21)13-10(3)18-16(22)19-14(13)11-8-6-7-9-12(11)17/h6-9,13-14H,4-5H2,1-3H3,(H,19,22) |
| InChIKey | OJNPDCGGPZUMEZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|