C20H22N4 — CID 123412970
1,2,3,4,5,7,8,9,21,24-decahydroporphyrin (PubChem CID 123412970) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1,2,3,4,5,7,8,9,21,24-decahydroporphyrin.
| Compound Name | 1,2,3,4,5,7,8,9,21,24-decahydroporphyrin |
|---|---|
| PubChem CID | 123412970 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1,2,3,4,5,7,8,9,21,24-decahydroporphyrin |
| SMILES | C1=CC2=NC1=CC1CCC(=N1)CC1CCC(C=c3ccc([nH]3)=C2)N1 |
| InChI | InChI=1S/C20H22N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-4,9-11,16,18-19,21,23H,5-8,12H2 |
| InChIKey | GLOIZRTWTGPILV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |