C24H29N5O2S — CID 123413149
(2,6-dimethylmorpholin-4-yl)-[4-[(4,5-dimethyl-2-pyridinyl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 123413149) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-[4-[(4,5-dimethyl-2-pyridinyl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-[4-[(4,5-dimethyl-2-pyridinyl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 123413149 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-[4-[(4,5-dimethyl-2-pyridinyl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | Cc1cnc(Nc2ncnc3sc4c(c23)CCC(C(=O)N2CC(C)OC(C)C2)C4)cc1C |
| InChI | InChI=1S/C24H29N5O2S/c1-13-7-20(25-9-14(13)2)28-22-21-18-6-5-17(8-19(18)32-23(21)27-12-26-22)24(30)29-10-15(3)31-16(4)11-29/h7,9,12,15-17H,5-6,8,10-11H2,1-4H3,(H,25,26,27,28) |
| InChIKey | XIDBPPGNMVMJDI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |