About 2-methoxyethyl(dimethyl)silane;methylsilane
2-methoxyethyl(dimethyl)silane;methylsilane (PubChem CID 123413175) has the molecular formula C6H20OSi2
and a molecular weight of 164.40 g/mol. Its IUPAC name is 2-methoxyethyl(dimethyl)silane;methylsilane.
Molecular Properties
| Compound Name | 2-methoxyethyl(dimethyl)silane;methylsilane |
| PubChem CID | 123413175 |
| Molecular Formula | C6H20OSi2 |
| Molecular Weight | 164.40 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-methoxyethyl(dimethyl)silane;methylsilane |
| SMILES | COCC[SiH](C)C.C[SiH3] |
| InChI | InChI=1S/C5H14OSi.CH6Si/c1-6-4-5-7(2)3;1-2/h7H,4-5H2,1-3H3;1-2H3 |
| InChIKey | VNHOKDBYBUBVJF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl(dimethyl)silane;methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl(dimethyl)silane;methylsilane?
The IUPAC name of 2-methoxyethyl(dimethyl)silane;methylsilane (CID 123413175) is 2-methoxyethyl(dimethyl)silane;methylsilane.
What is the SMILES notation for 2-methoxyethyl(dimethyl)silane;methylsilane?
The canonical SMILES for 2-methoxyethyl(dimethyl)silane;methylsilane is COCC[SiH](C)C.C[SiH3].
What is the InChIKey of 2-methoxyethyl(dimethyl)silane;methylsilane?
The InChIKey is VNHOKDBYBUBVJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14OSi.CH6Si/c1-6-4-5-7(2)3;1-2/h7H,4-5H2,1-3H3;1-2H3.
What are the key properties of 2-methoxyethyl(dimethyl)silane;methylsilane?
2-methoxyethyl(dimethyl)silane;methylsilane has a molecular weight of 164.40 g/mol, XLogP of 0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl(dimethyl)silane;methylsilane is sourced from PubChem (CID 123413175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).