About (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate
(6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate (PubChem CID 123413452) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate.
Molecular Properties
| Compound Name | (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate |
| PubChem CID | 123413452 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate |
| SMILES | CCC(CC(C)C)C(=O)OC1(C)C(C)CC23CC2CC1C3 |
| InChI | InChI=1S/C19H32O2/c1-6-14(7-12(2)3)17(20)21-18(5)13(4)9-19-10-15(18)8-16(19)11-19/h12-16H,6-11H2,1-5H3 |
| InChIKey | MPJULQNHHVSFCY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate?
The IUPAC name of (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate (CID 123413452) is (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate.
What is the SMILES notation for (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate?
The canonical SMILES for (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate is CCC(CC(C)C)C(=O)OC1(C)C(C)CC23CC2CC1C3.
What is the InChIKey of (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate?
The InChIKey is MPJULQNHHVSFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O2/c1-6-14(7-12(2)3)17(20)21-18(5)13(4)9-19-10-15(18)8-16(19)11-19/h12-16H,6-11H2,1-5H3.
What are the key properties of (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate?
(6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate has a molecular weight of 292.46 g/mol, XLogP of 4.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-ethyl-4-methylpentanoate is sourced from PubChem (CID 123413452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).