C24H26ClFN4O3S — CID 123413522
[4-[[5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]amino]cyclohexyl]methanesulfonic acid (PubChem CID 123413522) has the molecular formula C24H26ClFN4O3S and a molecular weight of 505.02 g/mol. Its IUPAC name is [4-[[5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]amino]cyclohexyl]methanesulfonic acid.
| Compound Name | [4-[[5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]amino]cyclohexyl]methanesulfonic acid |
|---|---|
| PubChem CID | 123413522 |
| Molecular Formula | C24H26ClFN4O3S |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [4-[[5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]amino]cyclohexyl]methanesulfonic acid |
| SMILES | O=S(=O)(O)CC1CCC(Nc2cc(-c3cccc(NCc4cccc(F)c4)n3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C24H26ClFN4O3S/c25-21-14-28-24(29-19-9-7-16(8-10-19)15-34(31,32)33)12-20(21)22-5-2-6-23(30-22)27-13-17-3-1-4-18(26)11-17/h1-6,11-12,14,16,19H,7-10,13,15H2,(H,27,30)(H,28,29)(H,31,32,33) |
| InChIKey | ABYBLHQIQOOHLI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|