C25H42O2 — CID 123413634
(4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 123413634) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 123413634 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (4-ethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CCC1(OC(=O)C(CC(C)(C)C)C(C)(C)C)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C25H42O2/c1-8-25(27-22(26)19(24(5,6)7)14-23(2,3)4)13-17-12-18(25)21-16-10-9-15(11-16)20(17)21/h15-21H,8-14H2,1-7H3 |
| InChIKey | PKXIHWHDZBECDT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|