C22H20ClFN2O7S — CID 123414148
[6-chloro-3-[(4-fluoro-3-sulfamoylphenyl)methyl]-4-methyl-2-oxochromen-7-yl] morpholine-4-carboxylate (PubChem CID 123414148) has the molecular formula C22H20ClFN2O7S and a molecular weight of 510.93 g/mol. Its IUPAC name is [6-chloro-3-[(4-fluoro-3-sulfamoylphenyl)methyl]-4-methyl-2-oxochromen-7-yl] morpholine-4-carboxylate.
| Compound Name | [6-chloro-3-[(4-fluoro-3-sulfamoylphenyl)methyl]-4-methyl-2-oxochromen-7-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 123414148 |
| Molecular Formula | C22H20ClFN2O7S |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | [6-chloro-3-[(4-fluoro-3-sulfamoylphenyl)methyl]-4-methyl-2-oxochromen-7-yl] morpholine-4-carboxylate |
| SMILES | Cc1c(Cc2ccc(F)c(S(N)(=O)=O)c2)c(=O)oc2cc(OC(=O)N3CCOCC3)c(Cl)cc12 |
| InChI | InChI=1S/C22H20ClFN2O7S/c1-12-14-10-16(23)19(33-22(28)26-4-6-31-7-5-26)11-18(14)32-21(27)15(12)8-13-2-3-17(24)20(9-13)34(25,29)30/h2-3,9-11H,4-8H2,1H3,(H2,25,29,30) |
| InChIKey | RISXQKSCKAMNPY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|