About 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene
10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene (PubChem CID 123414166) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene.
Molecular Properties
| Compound Name | 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene |
| PubChem CID | 123414166 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene |
| SMILES | CC1C=CC2=C(C=C1)OCCNC2 |
| InChI | InChI=1S/C11H15NO/c1-9-2-4-10-8-12-6-7-13-11(10)5-3-9/h2-5,9,12H,6-8H2,1H3 |
| InChIKey | YUXOCLQQDBKGDY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene?
The IUPAC name of 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene (CID 123414166) is 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene.
What is the SMILES notation for 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene?
The canonical SMILES for 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene is CC1C=CC2=C(C=C1)OCCNC2.
What is the InChIKey of 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene?
The InChIKey is YUXOCLQQDBKGDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-9-2-4-10-8-12-6-7-13-11(10)5-3-9/h2-5,9,12H,6-8H2,1H3.
What are the key properties of 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene?
10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene has a molecular weight of 177.25 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-2-oxa-5-azabicyclo[5.5.0]dodeca-1(7),8,11-triene is sourced from PubChem (CID 123414166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).