About 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine
4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine (PubChem CID 123414169) has the molecular formula C10H11ClN2
and a molecular weight of 194.67 g/mol. Its IUPAC name is 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine.
Molecular Properties
| Compound Name | 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine |
| PubChem CID | 123414169 |
| Molecular Formula | C10H11ClN2 |
| Molecular Weight | 194.67 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine |
| SMILES | CCC1=CN=c2[nH]ccc2=C(Cl)C1 |
| InChI | InChI=1S/C10H11ClN2/c1-2-7-5-9(11)8-3-4-12-10(8)13-6-7/h3-4,6H,2,5H2,1H3,(H,12,13) |
| InChIKey | QCKYQWBQFUCRSC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine?
The IUPAC name of 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine (CID 123414169) is 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine.
What is the SMILES notation for 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine?
The canonical SMILES for 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine is CCC1=CN=c2[nH]ccc2=C(Cl)C1.
What is the InChIKey of 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine?
The InChIKey is QCKYQWBQFUCRSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2/c1-2-7-5-9(11)8-3-4-12-10(8)13-6-7/h3-4,6H,2,5H2,1H3,(H,12,13).
What are the key properties of 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine?
4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine has a molecular weight of 194.67 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-ethyl-1,5-dihydropyrrolo[2,3-b]azepine is sourced from PubChem (CID 123414169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).