C12H26N2O2Si2 — CID 123414674
1-N,4-N-bis(trimethylsilyloxy)cyclohexa-1,3-diene-1,4-diamine (PubChem CID 123414674) has the molecular formula C12H26N2O2Si2 and a molecular weight of 286.52 g/mol. Its IUPAC name is 1-N,4-N-bis(trimethylsilyloxy)cyclohexa-1,3-diene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(trimethylsilyloxy)cyclohexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 123414674 |
| Molecular Formula | C12H26N2O2Si2 |
| Molecular Weight | 286.52 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-N,4-N-bis(trimethylsilyloxy)cyclohexa-1,3-diene-1,4-diamine |
| SMILES | C[Si](C)(C)ONC1=CC=C(NO[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C12H26N2O2Si2/c1-17(2,3)15-13-11-7-9-12(10-8-11)14-16-18(4,5)6/h7,9,13-14H,8,10H2,1-6H3 |
| InChIKey | WBQJXBSPBWLMBI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|