C49H50N3O3+ — CID 123414678
(2-hydroxy-2-methylbutyl) 2-ethyl-2-methyl-3-[4-[(5-phenyl-9-pyridin-1-ium-1-ylindolo[3,2-c]carbazol-12-yl)methyl]phenyl]pentanoate (PubChem CID 123414678) has the molecular formula C49H50N3O3+ and a molecular weight of 728.96 g/mol. Its IUPAC name is (2-hydroxy-2-methylbutyl) 2-ethyl-2-methyl-3-[4-[(5-phenyl-9-pyridin-1-ium-1-ylindolo[3,2-c]carbazol-12-yl)methyl]phenyl]pentanoate.
| Compound Name | (2-hydroxy-2-methylbutyl) 2-ethyl-2-methyl-3-[4-[(5-phenyl-9-pyridin-1-ium-1-ylindolo[3,2-c]carbazol-12-yl)methyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 123414678 |
| Molecular Formula | C49H50N3O3+ |
| Molecular Weight | 728.96 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | (2-hydroxy-2-methylbutyl) 2-ethyl-2-methyl-3-[4-[(5-phenyl-9-pyridin-1-ium-1-ylindolo[3,2-c]carbazol-12-yl)methyl]phenyl]pentanoate |
| SMILES | CCC(c1ccc(Cn2c3ccc(-[n+]4ccccc4)cc3c3ccc4c(c5ccccc5n4-c4ccccc4)c32)cc1)C(C)(CC)C(=O)OCC(C)(O)CC |
| InChI | InChI=1S/C49H50N3O3/c1-6-41(49(5,8-3)47(53)55-33-48(4,54)7-2)35-23-21-34(22-24-35)32-51-42-27-25-37(50-29-15-10-16-30-50)31-40(42)38-26-28-44-45(46(38)51)39-19-13-14-20-43(39)52(44)36-17-11-9-12-18-36/h9-31,41,54H,6-8,32-33H2,1-5H3/q+1 |
| InChIKey | FXSQLBRLXWFAGK-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.96 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|