C43H58N12O17 — CID 123414925
(2,5-dihydroxypyrrol-1-yl) 3-[2,6-bis[[2-[[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]propanoylamino]acetyl]amino]acetyl]amino]hexanoylamino]propanoate (PubChem CID 123414925) has the molecular formula C43H58N12O17 and a molecular weight of 1015.00 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[2,6-bis[[2-[[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]propanoylamino]acetyl]amino]acetyl]amino]hexanoylamino]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[2,6-bis[[2-[[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]propanoylamino]acetyl]amino]acetyl]amino]hexanoylamino]propanoate |
|---|---|
| PubChem CID | 123414925 |
| Molecular Formula | C43H58N12O17 |
| Molecular Weight | 1015.00 g/mol |
| Exact Mass | 1014.40 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[2,6-bis[[2-[[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]propanoylamino]acetyl]amino]acetyl]amino]hexanoylamino]propanoate |
| SMILES | CC(NC(=O)CCCN1C(=O)C=CC1=O)C(=O)NCC(=O)NCC(=O)NCCCCC(NC(=O)CNC(=O)CNC(=O)C(C)NC(=O)CCCN1C(=O)C=CC1=O)C(=O)NCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C43H58N12O17/c1-25(50-28(56)8-5-19-53-34(62)10-11-35(53)63)41(69)48-22-31(59)46-21-30(58)44-17-4-3-7-27(43(71)45-18-16-40(68)72-55-38(66)14-15-39(55)67)52-33(61)24-47-32(60)23-49-42(70)26(2)51-29(57)9-6-20-54-36(64)12-13-37(54)65/h10-15,25-27,66-67H,3-9,16-24H2,1-2H3,(H,44,58)(H,45,71)(H,46,59)(H,47,60)(H,48,69)(H,49,70)(H,50,56)(H,51,57)(H,52,61) |
| InChIKey | QAYFGGQTUIRQRH-UHFFFAOYSA-N |
| XLogP | -5.98 |
| TPSA | 408.35 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.00 |
| LogP ≤ 5 | -5.98 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|