C18H29N — CID 123415048
(5Z,7E)-N-hexyl-4-methylundeca-1,5,7,9-tetraen-3-imine (PubChem CID 123415048) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (5Z,7E)-N-hexyl-4-methylundeca-1,5,7,9-tetraen-3-imine.
| Compound Name | (5Z,7E)-N-hexyl-4-methylundeca-1,5,7,9-tetraen-3-imine |
|---|---|
| PubChem CID | 123415048 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (5Z,7E)-N-hexyl-4-methylundeca-1,5,7,9-tetraen-3-imine |
| SMILES | C=C/C(=N\CCCCCC)C(C)/C=C\C=C\C=CC |
| InChI | InChI=1S/C18H29N/c1-5-8-10-12-13-15-17(4)18(7-3)19-16-14-11-9-6-2/h5,7-8,10,12-13,15,17H,3,6,9,11,14,16H2,1-2,4H3/b8-5?,12-10+,15-13-,19-18+ |
| InChIKey | BRIVVYZCWWHMPR-JQIRWXKKSA-N |
| XLogP | 5.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|