C19H17Cl2F3N3+ — CID 123415495
aminomethylidene-[[4-[3-(2,3-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-methylazanium (PubChem CID 123415495) has the molecular formula C19H17Cl2F3N3+ and a molecular weight of 415.27 g/mol. Its IUPAC name is aminomethylidene-[[4-[3-(2,3-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-methylazanium.
| Compound Name | aminomethylidene-[[4-[3-(2,3-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-methylazanium |
|---|---|
| PubChem CID | 123415495 |
| Molecular Formula | C19H17Cl2F3N3+ |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | aminomethylidene-[[4-[3-(2,3-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-methylazanium |
| SMILES | C[N+](/C=N/c1ccc(C=CC(c2cccc(Cl)c2Cl)C(F)(F)F)cc1)=C\N |
| InChI | InChI=1S/C19H16Cl2F3N3/c1-27(11-25)12-26-14-8-5-13(6-9-14)7-10-16(19(22,23)24)15-3-2-4-17(20)18(15)21/h2-12,16,25H,1H3/p+1/b10-7?,26-12+ |
| InChIKey | UNNZMFPFCPRFKI-HYADVLKFSA-O |
| XLogP | 5.64 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|