C26H28N4O2 — CID 123415980
2-methyl-N-[3-[1-(6-phenyl-2-pyridinyl)ethylideneamino]oxypropoxy]-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 123415980) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-methyl-N-[3-[1-(6-phenyl-2-pyridinyl)ethylideneamino]oxypropoxy]-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | 2-methyl-N-[3-[1-(6-phenyl-2-pyridinyl)ethylideneamino]oxypropoxy]-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 123415980 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-methyl-N-[3-[1-(6-phenyl-2-pyridinyl)ethylideneamino]oxypropoxy]-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | CC(=NOCCCON=C1CCCc2ccc(C)nc21)c1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H28N4O2/c1-19-15-16-22-11-6-14-25(26(22)27-19)30-32-18-8-17-31-29-20(2)23-12-7-13-24(28-23)21-9-4-3-5-10-21/h3-5,7,9-10,12-13,15-16H,6,8,11,14,17-18H2,1-2H3 |
| InChIKey | HWWSDNOZVYWNDY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|