C29H33F5N4O5 — CID 123416001
2-fluoro-N-[1-[1-[(2-fluoro-4-methoxycyclohexa-1,3-dien-1-yl)methyl]-3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-3-methyl-1-oxobutan-2-yl]-5-(trifluoromethyl)benzamide (PubChem CID 123416001) has the molecular formula C29H33F5N4O5 and a molecular weight of 612.60 g/mol. Its IUPAC name is 2-fluoro-N-[1-[1-[(2-fluoro-4-methoxycyclohexa-1,3-dien-1-yl)methyl]-3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-3-methyl-1-oxobutan-2-yl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-[1-[1-[(2-fluoro-4-methoxycyclohexa-1,3-dien-1-yl)methyl]-3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-3-methyl-1-oxobutan-2-yl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123416001 |
| Molecular Formula | C29H33F5N4O5 |
| Molecular Weight | 612.60 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | 2-fluoro-N-[1-[1-[(2-fluoro-4-methoxycyclohexa-1,3-dien-1-yl)methyl]-3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-3-methyl-1-oxobutan-2-yl]-5-(trifluoromethyl)benzamide |
| SMILES | COC1=CC(F)=C(CN2C(=O)N(C)C(=O)C23CCN(C(=O)C(NC(=O)c2cc(C(F)(F)F)ccc2F)C(C)C)CC3)CC1 |
| InChI | InChI=1S/C29H33F5N4O5/c1-16(2)23(35-24(39)20-13-18(29(32,33)34)6-8-21(20)30)25(40)37-11-9-28(10-12-37)26(41)36(3)27(42)38(28)15-17-5-7-19(43-4)14-22(17)31/h6,8,13-14,16,23H,5,7,9-12,15H2,1-4H3,(H,35,39) |
| InChIKey | GLGMSVOXXUKRBQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|