C24H40N2 — CID 123416111
(E,2E,4E,5Z)-3,6,7,9-tetramethyl-N-(methylideneamino)-4-(2-methylprop-2-enylidene)-2-pentyldeca-2,5-dien-1-imine (PubChem CID 123416111) has the molecular formula C24H40N2 and a molecular weight of 356.60 g/mol. Its IUPAC name is (E,2E,4E,5Z)-3,6,7,9-tetramethyl-N-(methylideneamino)-4-(2-methylprop-2-enylidene)-2-pentyldeca-2,5-dien-1-imine.
| Compound Name | (E,2E,4E,5Z)-3,6,7,9-tetramethyl-N-(methylideneamino)-4-(2-methylprop-2-enylidene)-2-pentyldeca-2,5-dien-1-imine |
|---|---|
| PubChem CID | 123416111 |
| Molecular Formula | C24H40N2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | (E,2E,4E,5Z)-3,6,7,9-tetramethyl-N-(methylideneamino)-4-(2-methylprop-2-enylidene)-2-pentyldeca-2,5-dien-1-imine |
| SMILES | C=N/N=C/C(CCCCC)=C(C)/C(/C=C(/C)C(C)CC(C)C)=C/C(=C)C |
| InChI | InChI=1S/C24H40N2/c1-10-11-12-13-23(17-26-25-9)22(8)24(15-19(4)5)16-21(7)20(6)14-18(2)3/h15-18,20H,4,9-14H2,1-3,5-8H3/b21-16-,23-22+,24-15+,26-17+ |
| InChIKey | RUDCRKRQVOOLSB-MBOMNVNDSA-N |
| XLogP | 7.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|