C36H48F2N4O7 — CID 123416132
2-methylpropyl 24-tert-butyl-13,13-difluoro-7-methoxy-22,25-dioxo-28-propyl-2,21-dioxa-4,11,23,26-tetrazapentacyclo[24.2.1.03,12.05,10.018,20]nonacosa-3,5(10),6,8,11,14-hexaene-27-carboxylate (PubChem CID 123416132) has the molecular formula C36H48F2N4O7 and a molecular weight of 686.80 g/mol. Its IUPAC name is 2-methylpropyl 24-tert-butyl-13,13-difluoro-7-methoxy-22,25-dioxo-28-propyl-2,21-dioxa-4,11,23,26-tetrazapentacyclo[24.2.1.03,12.05,10.018,20]nonacosa-3,5(10),6,8,11,14-hexaene-27-carboxylate.
| Compound Name | 2-methylpropyl 24-tert-butyl-13,13-difluoro-7-methoxy-22,25-dioxo-28-propyl-2,21-dioxa-4,11,23,26-tetrazapentacyclo[24.2.1.03,12.05,10.018,20]nonacosa-3,5(10),6,8,11,14-hexaene-27-carboxylate |
|---|---|
| PubChem CID | 123416132 |
| Molecular Formula | C36H48F2N4O7 |
| Molecular Weight | 686.80 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | 2-methylpropyl 24-tert-butyl-13,13-difluoro-7-methoxy-22,25-dioxo-28-propyl-2,21-dioxa-4,11,23,26-tetrazapentacyclo[24.2.1.03,12.05,10.018,20]nonacosa-3,5(10),6,8,11,14-hexaene-27-carboxylate |
| SMILES | CCCC1C2CN(C(=O)C(C(C)(C)C)NC(=O)OC3CC3CCC=CC(F)(F)c3nc4ccc(OC)cc4nc3O2)C1C(=O)OCC(C)C |
| InChI | InChI=1S/C36H48F2N4O7/c1-8-11-23-27-18-42(28(23)33(44)47-19-20(2)3)32(43)30(35(4,5)6)41-34(45)49-26-16-21(26)12-9-10-15-36(37,38)29-31(48-27)40-25-17-22(46-7)13-14-24(25)39-29/h10,13-15,17,20-21,23,26-28,30H,8-9,11-12,16,18-19H2,1-7H3,(H,41,45) |
| InChIKey | PGJDSSJRUXWNNI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|