C28H32F5N5O6 — CID 123416356
3-hydroxy-N-[10-hydroxy-5,11-dimethyl-2-(2-methylpropyl)-3,7,12-trioxo-9-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,4,8-triazacyclododec-6-yl]pyridine-2-carboxamide (PubChem CID 123416356) has the molecular formula C28H32F5N5O6 and a molecular weight of 629.58 g/mol. Its IUPAC name is 3-hydroxy-N-[10-hydroxy-5,11-dimethyl-2-(2-methylpropyl)-3,7,12-trioxo-9-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,4,8-triazacyclododec-6-yl]pyridine-2-carboxamide.
| Compound Name | 3-hydroxy-N-[10-hydroxy-5,11-dimethyl-2-(2-methylpropyl)-3,7,12-trioxo-9-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,4,8-triazacyclododec-6-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123416356 |
| Molecular Formula | C28H32F5N5O6 |
| Molecular Weight | 629.58 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | 3-hydroxy-N-[10-hydroxy-5,11-dimethyl-2-(2-methylpropyl)-3,7,12-trioxo-9-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,4,8-triazacyclododec-6-yl]pyridine-2-carboxamide |
| SMILES | CC(C)CC1NC(=O)C(C)C(O)C(Cc2c(F)c(F)c(F)c(F)c2F)NC(=O)C(NC(=O)c2ncccc2O)C(C)NC1=O |
| InChI | InChI=1S/C28H32F5N5O6/c1-10(2)8-15-26(42)35-12(4)22(38-28(44)23-16(39)6-5-7-34-23)27(43)36-14(24(40)11(3)25(41)37-15)9-13-17(29)19(31)21(33)20(32)18(13)30/h5-7,10-12,14-15,22,24,39-40H,8-9H2,1-4H3,(H,35,42)(H,36,43)(H,37,41)(H,38,44) |
| InChIKey | YAYPLARYWRPEDV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 169.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.58 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|