C17H30N2O — CID 123416590
2-ethylidene-N-(2,2,6,6-tetramethylpiperidin-4-yl)hex-3-enamide (PubChem CID 123416590) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-ethylidene-N-(2,2,6,6-tetramethylpiperidin-4-yl)hex-3-enamide.
| Compound Name | 2-ethylidene-N-(2,2,6,6-tetramethylpiperidin-4-yl)hex-3-enamide |
|---|---|
| PubChem CID | 123416590 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2-ethylidene-N-(2,2,6,6-tetramethylpiperidin-4-yl)hex-3-enamide |
| SMILES | CC=C(C=CCC)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H30N2O/c1-7-9-10-13(8-2)15(20)18-14-11-16(3,4)19-17(5,6)12-14/h8-10,14,19H,7,11-12H2,1-6H3,(H,18,20) |
| InChIKey | MZMVGOPVXYUOLJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|