C20H24N8O2 — CID 123417343
5-[4-[[3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]pyrazol-1-yl]pentan-1-ol (PubChem CID 123417343) has the molecular formula C20H24N8O2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 5-[4-[[3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]pyrazol-1-yl]pentan-1-ol.
| Compound Name | 5-[4-[[3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]pyrazol-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 123417343 |
| Molecular Formula | C20H24N8O2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 5-[4-[[3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]pyrazol-1-yl]pentan-1-ol |
| SMILES | CCOc1ccc(-n2nnc3cnc(Nc4cnn(CCCCCO)c4)nc32)cc1 |
| InChI | InChI=1S/C20H24N8O2/c1-2-30-17-8-6-16(7-9-17)28-19-18(25-26-28)13-21-20(24-19)23-15-12-22-27(14-15)10-4-3-5-11-29/h6-9,12-14,29H,2-5,10-11H2,1H3,(H,21,23,24) |
| InChIKey | RBVUIOHJYKBMOT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|