C16H12F3NO — CID 123417533
3-phenyl-5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole (PubChem CID 123417533) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-phenyl-5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-phenyl-5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 123417533 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-phenyl-5-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)c1ccc(C2C=C(c3ccccc3)NO2)cc1 |
| InChI | InChI=1S/C16H12F3NO/c17-16(18,19)13-8-6-12(7-9-13)15-10-14(20-21-15)11-4-2-1-3-5-11/h1-10,15,20H |
| InChIKey | YMPSYRBTQVJZPK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |