C17H20N2O3S2 — CID 123417601
N-(4-methoxy-14-thia-1-azatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,11(15),12-pentaen-5-yl)methanesulfonamide (PubChem CID 123417601) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(4-methoxy-14-thia-1-azatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,11(15),12-pentaen-5-yl)methanesulfonamide.
| Compound Name | N-(4-methoxy-14-thia-1-azatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,11(15),12-pentaen-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 123417601 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(4-methoxy-14-thia-1-azatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,11(15),12-pentaen-5-yl)methanesulfonamide |
| SMILES | COc1c(NS(C)(=O)=O)ccc2c1CN1CCc3sccc3C1C2 |
| InChI | InChI=1S/C17H20N2O3S2/c1-22-17-13-10-19-7-5-16-12(6-8-23-16)15(19)9-11(13)3-4-14(17)18-24(2,20)21/h3-4,6,8,15,18H,5,7,9-10H2,1-2H3 |
| InChIKey | YGWKXFFGHAYRGD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |