C27H41N3O4 — CID 123417672
1-[2-(2-azaspiro[5.7]tridecan-4-yl)-2-oxoethyl]-5-(cyclohexen-1-yl)-3-ethyl-5-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 123417672) has the molecular formula C27H41N3O4 and a molecular weight of 471.64 g/mol. Its IUPAC name is 1-[2-(2-azaspiro[5.7]tridecan-4-yl)-2-oxoethyl]-5-(cyclohexen-1-yl)-3-ethyl-5-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-(2-azaspiro[5.7]tridecan-4-yl)-2-oxoethyl]-5-(cyclohexen-1-yl)-3-ethyl-5-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 123417672 |
| Molecular Formula | C27H41N3O4 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 1-[2-(2-azaspiro[5.7]tridecan-4-yl)-2-oxoethyl]-5-(cyclohexen-1-yl)-3-ethyl-5-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)N(CC(=O)C2CNCC3(CCCCCCC3)C2)C(=O)C(C)(C2=CCCCC2)C1=O |
| InChI | InChI=1S/C27H41N3O4/c1-3-29-23(32)26(2,21-12-8-7-9-13-21)24(33)30(25(29)34)18-22(31)20-16-27(19-28-17-20)14-10-5-4-6-11-15-27/h12,20,28H,3-11,13-19H2,1-2H3 |
| InChIKey | YZPQDHCGVZFQAM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|