About 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide
4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 123417701) has the molecular formula C8H12FNO2S
and a molecular weight of 205.25 g/mol. Its IUPAC name is 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide |
| PubChem CID | 123417701 |
| Molecular Formula | C8H12FNO2S |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)C1=CCC(F)C=C1 |
| InChI | InChI=1S/C8H12FNO2S/c1-10(2)13(11,12)8-5-3-7(9)4-6-8/h3,5-7H,4H2,1-2H3 |
| InChIKey | MUWCHRROKCBTRG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide?
The IUPAC name of 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide (CID 123417701) is 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide.
What is the SMILES notation for 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide?
The canonical SMILES for 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide is CN(C)S(=O)(=O)C1=CCC(F)C=C1.
What is the InChIKey of 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide?
The InChIKey is MUWCHRROKCBTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FNO2S/c1-10(2)13(11,12)8-5-3-7(9)4-6-8/h3,5-7H,4H2,1-2H3.
What are the key properties of 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide?
4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide has a molecular weight of 205.25 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,N-dimethylcyclohexa-1,5-diene-1-sulfonamide is sourced from PubChem (CID 123417701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).