About N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline
N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline (PubChem CID 123417724) has the molecular formula C50H55N
and a molecular weight of 670.00 g/mol. Its IUPAC name is N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline.
Molecular Properties
| Compound Name | N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline |
| PubChem CID | 123417724 |
| Molecular Formula | C50H55N |
| Molecular Weight | 670.00 g/mol |
| Exact Mass | 669.43 |
| IUPAC Name | N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline |
| SMILES | CCc1cc(C(C)(C)C)ccc1-c1ccc(N(c2ccc(-c3ccc(C)cc3C)cc2)c2ccc(-c3ccc(C(C)(C)C)cc3CC)cc2)cc1 |
| InChI | InChI=1S/C50H55N/c1-11-36-32-41(49(5,6)7)20-29-47(36)39-16-24-44(25-17-39)51(43-22-14-38(15-23-43)46-28-13-34(3)31-35(46)4)45-26-18-40(19-27-45)48-30-21-42(50(8,9)10)33-37(48)12-2/h13-33H,11-12H2,1-10H3 |
| InChIKey | YSDWEWSYADSHSL-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 670.00 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline?
The IUPAC name of N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline (CID 123417724) is N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline.
What is the SMILES notation for N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline?
The canonical SMILES for N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline is CCc1cc(C(C)(C)C)ccc1-c1ccc(N(c2ccc(-c3ccc(C)cc3C)cc2)c2ccc(-c3ccc(C(C)(C)C)cc3CC)cc2)cc1.
What is the InChIKey of N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline?
The InChIKey is YSDWEWSYADSHSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C50H55N/c1-11-36-32-41(49(5,6)7)20-29-47(36)39-16-24-44(25-17-39)51(43-22-14-38(15-23-43)46-28-13-34(3)31-35(46)4)45-26-18-40(19-27-45)48-30-21-42(50(8,9)10)33-37(48)12-2/h13-33H,11-12H2,1-10H3.
What are the key properties of N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline?
N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline has a molecular weight of 670.00 g/mol, XLogP of 14.49, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[4-(4-tert-butyl-2-ethylphenyl)phenyl]-4-(2,4-dimethylphenyl)aniline is sourced from PubChem (CID 123417724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).