C25H30N2O4 — CID 123418074
5-[[4-[hydroxy(phenyl)methyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-methylamino]-5-oxopentanoic acid (PubChem CID 123418074) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-[[4-[hydroxy(phenyl)methyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-[hydroxy(phenyl)methyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123418074 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-[[4-[hydroxy(phenyl)methyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-methylamino]-5-oxopentanoic acid |
| SMILES | CN(C(=O)CCCC(=O)O)C1c2ccccc2N(C(O)c2ccccc2)C2CCCC12 |
| InChI | InChI=1S/C25H30N2O4/c1-26(22(28)15-8-16-23(29)30)24-18-11-5-6-13-20(18)27(21-14-7-12-19(21)24)25(31)17-9-3-2-4-10-17/h2-6,9-11,13,19,21,24-25,31H,7-8,12,14-16H2,1H3,(H,29,30) |
| InChIKey | KCHSUYIPEFHNQR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |