C25H21F3N2O3S — CID 123418322
1-(5-methyl-1,3-thiazol-2-yl)-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 123418322) has the molecular formula C25H21F3N2O3S and a molecular weight of 486.52 g/mol. Its IUPAC name is 1-(5-methyl-1,3-thiazol-2-yl)-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 1-(5-methyl-1,3-thiazol-2-yl)-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123418322 |
| Molecular Formula | C25H21F3N2O3S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 1-(5-methyl-1,3-thiazol-2-yl)-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | Cc1cnc(N2C(=O)C(=O)C(C(=O)c3ccc(C(C)C)cc3)C2c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C25H21F3N2O3S/c1-13(2)15-4-6-17(7-5-15)21(31)19-20(16-8-10-18(11-9-16)25(26,27)28)30(23(33)22(19)32)24-29-12-14(3)34-24/h4-13,19-20H,1-3H3 |
| InChIKey | HQBAYGZLGLWRFF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|