About (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide
(2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide (PubChem CID 123418440) has the molecular formula C13H23NOS
and a molecular weight of 241.40 g/mol. Its IUPAC name is (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide.
Molecular Properties
| Compound Name | (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide |
| PubChem CID | 123418440 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide |
| SMILES | C=C(C)C/C=C(\C)S(=O)N=CCCCCC |
| InChI | InChI=1S/C13H23NOS/c1-5-6-7-8-11-14-16(15)13(4)10-9-12(2)3/h10-11H,2,5-9H2,1,3-4H3/b13-10+,14-11? |
| InChIKey | YPRDLBPPGPTDSI-PEELMVAHSA-N |
| XLogP | 4.17 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide?
The IUPAC name of (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide (CID 123418440) is (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide.
What is the SMILES notation for (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide?
The canonical SMILES for (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide is C=C(C)C/C=C(\C)S(=O)N=CCCCCC.
What is the InChIKey of (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide?
The InChIKey is YPRDLBPPGPTDSI-PEELMVAHSA-N. The full InChI is InChI=1S/C13H23NOS/c1-5-6-7-8-11-14-16(15)13(4)10-9-12(2)3/h10-11H,2,5-9H2,1,3-4H3/b13-10+,14-11?.
What are the key properties of (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide?
(2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide has a molecular weight of 241.40 g/mol, XLogP of 4.17, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-hexylidene-5-methylhexa-2,5-diene-2-sulfinamide is sourced from PubChem (CID 123418440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).