About 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one
6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one (PubChem CID 123418809) has the molecular formula C15H9Br2ClN2O
and a molecular weight of 428.51 g/mol. Its IUPAC name is 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one |
| PubChem CID | 123418809 |
| Molecular Formula | C15H9Br2ClN2O |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 425.88 |
| IUPAC Name | 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccc(Cl)cc2nc1Cc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H9Br2ClN2O/c16-9-3-8(4-10(17)6-9)5-14-15(21)20-12-2-1-11(18)7-13(12)19-14/h1-4,6-7H,5H2,(H,20,21) |
| InChIKey | YUTFEGLCBCCEGK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one?
The IUPAC name of 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one (CID 123418809) is 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one.
What is the SMILES notation for 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one?
The canonical SMILES for 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one is O=c1[nH]c2ccc(Cl)cc2nc1Cc1cc(Br)cc(Br)c1.
What is the InChIKey of 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one?
The InChIKey is YUTFEGLCBCCEGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Br2ClN2O/c16-9-3-8(4-10(17)6-9)5-14-15(21)20-12-2-1-11(18)7-13(12)19-14/h1-4,6-7H,5H2,(H,20,21).
What are the key properties of 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one?
6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one has a molecular weight of 428.51 g/mol, XLogP of 4.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[(3,5-dibromophenyl)methyl]-1H-quinoxalin-2-one is sourced from PubChem (CID 123418809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).