C26H16N4O4 — CID 123419068
[(5-benzoyloxyiminopyrido[3,4-g]isoquinolin-10-ylidene)amino] benzoate (PubChem CID 123419068) has the molecular formula C26H16N4O4 and a molecular weight of 448.44 g/mol. Its IUPAC name is [(5-benzoyloxyiminopyrido[3,4-g]isoquinolin-10-ylidene)amino] benzoate.
| Compound Name | [(5-benzoyloxyiminopyrido[3,4-g]isoquinolin-10-ylidene)amino] benzoate |
|---|---|
| PubChem CID | 123419068 |
| Molecular Formula | C26H16N4O4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(5-benzoyloxyiminopyrido[3,4-g]isoquinolin-10-ylidene)amino] benzoate |
| SMILES | O=C(ON=C1c2ccncc2C(=NOC(=O)c2ccccc2)c2ccncc21)c1ccccc1 |
| InChI | InChI=1S/C26H16N4O4/c31-25(17-7-3-1-4-8-17)33-29-23-19-11-13-28-16-22(19)24(20-12-14-27-15-21(20)23)30-34-26(32)18-9-5-2-6-10-18/h1-16H |
| InChIKey | RSAHCXOCDXEBAM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 103.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|