C5H9N5S2 — CID 123419099
(N'-methanimidoylcarbamimidoyl)sulfanyl N-methanimidoylethanimidothioate (PubChem CID 123419099) has the molecular formula C5H9N5S2 and a molecular weight of 203.30 g/mol. Its IUPAC name is (N'-methanimidoylcarbamimidoyl)sulfanyl N-methanimidoylethanimidothioate.
| Compound Name | (N'-methanimidoylcarbamimidoyl)sulfanyl N-methanimidoylethanimidothioate |
|---|---|
| PubChem CID | 123419099 |
| Molecular Formula | C5H9N5S2 |
| Molecular Weight | 203.30 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | (N'-methanimidoylcarbamimidoyl)sulfanyl N-methanimidoylethanimidothioate |
| SMILES | [H]/N=C/N=C(\C)SS/C(N)=N/C=N/[H] |
| InChI | InChI=1S/C5H9N5S2/c1-4(9-2-6)11-12-5(8)10-3-7/h2-3,6H,1H3,(H3,7,8,10)/b6-2+,9-4+ |
| InChIKey | IHBUQDXHMMLDNK-MXHAZWSOSA-N |
| XLogP | 1.32 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|