C21H30O3 — CID 123419260
tert-butyl 3-[3-(2-methoxyphenyl)cyclohept-3-en-1-yl]propanoate (PubChem CID 123419260) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl 3-[3-(2-methoxyphenyl)cyclohept-3-en-1-yl]propanoate.
| Compound Name | tert-butyl 3-[3-(2-methoxyphenyl)cyclohept-3-en-1-yl]propanoate |
|---|---|
| PubChem CID | 123419260 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl 3-[3-(2-methoxyphenyl)cyclohept-3-en-1-yl]propanoate |
| SMILES | COc1ccccc1C1=CCCCC(CCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H30O3/c1-21(2,3)24-20(22)14-13-16-9-5-6-10-17(15-16)18-11-7-8-12-19(18)23-4/h7-8,10-12,16H,5-6,9,13-15H2,1-4H3 |
| InChIKey | FXVUGAUXKSTHJA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |