C10H19NO — CID 123419292
3-ethyl-5-methyl-1,2,3,4,5,8-hexahydroazocin-4-ol (PubChem CID 123419292) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 3-ethyl-5-methyl-1,2,3,4,5,8-hexahydroazocin-4-ol.
| Compound Name | 3-ethyl-5-methyl-1,2,3,4,5,8-hexahydroazocin-4-ol |
|---|---|
| PubChem CID | 123419292 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3-ethyl-5-methyl-1,2,3,4,5,8-hexahydroazocin-4-ol |
| SMILES | CCC1CNCC=CC(C)C1O |
| InChI | InChI=1S/C10H19NO/c1-3-9-7-11-6-4-5-8(2)10(9)12/h4-5,8-12H,3,6-7H2,1-2H3 |
| InChIKey | DOUJPUBSQAWIOD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|