About (2S)-2,6-diaminohexanimidamide
(2S)-2,6-diaminohexanimidamide (PubChem CID 123419427) has the molecular formula C6H16N4
and a molecular weight of 144.22 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanimidamide.
Molecular Properties
| Compound Name | (2S)-2,6-diaminohexanimidamide |
| PubChem CID | 123419427 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | (2S)-2,6-diaminohexanimidamide |
| SMILES | [H]/N=C(\N)[C@@H](N)CCCCN |
| InChI | InChI=1S/C6H16N4/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H3,9,10)/t5-/m0/s1 |
| InChIKey | JNYJYQOXLDCYHY-YFKPBYRVSA-N |
| XLogP | -0.62 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-diaminohexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diaminohexanimidamide?
The IUPAC name of (2S)-2,6-diaminohexanimidamide (CID 123419427) is (2S)-2,6-diaminohexanimidamide.
What is the SMILES notation for (2S)-2,6-diaminohexanimidamide?
The canonical SMILES for (2S)-2,6-diaminohexanimidamide is [H]/N=C(\N)[C@@H](N)CCCCN.
What is the InChIKey of (2S)-2,6-diaminohexanimidamide?
The InChIKey is JNYJYQOXLDCYHY-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H16N4/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H3,9,10)/t5-/m0/s1.
What are the key properties of (2S)-2,6-diaminohexanimidamide?
(2S)-2,6-diaminohexanimidamide has a molecular weight of 144.22 g/mol, XLogP of -0.62, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diaminohexanimidamide is sourced from PubChem (CID 123419427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).