C5H13O2PSi — CID 123419615
4,5-diethyl-1,3,2,4-dioxaphosphasilolane (PubChem CID 123419615) has the molecular formula C5H13O2PSi and a molecular weight of 164.22 g/mol. Its IUPAC name is 4,5-diethyl-1,3,2,4-dioxaphosphasilolane.
| Compound Name | 4,5-diethyl-1,3,2,4-dioxaphosphasilolane |
|---|---|
| PubChem CID | 123419615 |
| Molecular Formula | C5H13O2PSi |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 4,5-diethyl-1,3,2,4-dioxaphosphasilolane |
| SMILES | CCC1OPO[SiH]1CC |
| InChI | InChI=1S/C5H13O2PSi/c1-3-5-6-8-7-9(5)4-2/h5,8-9H,3-4H2,1-2H3 |
| InChIKey | ZCKXKJDLTUGQQS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|